1-Adamantylmethyl 4-methylbenzenesulfonate
1-adamantylmethyl 4-methylbenzenesulfonate
Also Known As: Maybridge1_002401|1-Adamantylmethyl tosylate|DivK1c_001153|HMS548F03|1-adamantylmethyl 4-methylbenzenesulfonate|1-adamantylmethyl p-toluenesulfonate|CDS1_000113|(adamantan-1-yl)methyl 4-methylbenzene-1-sulfonate|HS-3468|adamantanylmethyl 4-methylbenzenesulfonate|J1.402.889G|p-Toluenesulfonic acid 1-adamantylmethyl ester|p-Toluenesulfonic acid adamantane-1-ylmethyl ester|ADAMANTAN-1-YLMETHYL 4-METHYLBENZENESULFONATE|[(3r)-adamantan-1-yl]methyl 4-methylbenzene-1-sulfonate|TOLUENE-4-SULFONIC ACID ADAMANTAN-1-YLMETHYL ESTER|(Tricyclo(3.3.1.1(3,7))decan-1-yl)methyl p-toluenesulfonate|p-Toluenesulfonic acid tricyclo[3.3.1.13,7]decane-1-ylmethyl ester|tricyclo[3.3.1.1~3,7~]dec-1-ylmethyl 4-methylbenzenesulfonate
| Molecular Formula | C18H24O3S |
|---|---|
| Molecular Weight | 320.14462 g/mol |
| LogP | 3.91672 |
| Topological Polar Surface Area | 43.37 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 320.14462 |
| Monoisotopic Mass | 320.14462 |
| Heavy Atoms | 22 |
| Complexity | 624.7934 |
Chemical Identifiers
| CAS Number | 795-63-1 |
|---|---|
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC23CC4CC(C2)CC(C4)C3 |
Product Overview
1-Adamantylmethyl 4-methylbenzenesulfonate (CAS 795-63-1), with molecular formula C18H24O3S and molecular weight 320.14462 g/mol. IUPAC: 1-adamantylmethyl 4-methylbenzenesulfonate.