Methanone, (6-chloro-3-pyridinyl)phenyl-
(6-chloro-3-pyridinyl)-phenylmethanone
Also Known As: 2-Chloro-5-benzoylpyridine|5-Benzoyl-2-chloropyridine|3-Benzoyl-6-chloropyridine|(6-chloropyridin-3-yl)(phenyl)methanone|(6-chloropyridin-3-yl)-phenylmethanone|(6-Chloro-3-pyridinyl)phenylmethanone|Methanone, (6-chloro-3-pyridinyl)phenyl-|Methanone,(6-chloro-3-pyridinyl)phenyl-|Phenyl(6-chloro-3-pyridinyl) ketone|(6-chloro-3-pyridyl)-phenyl-methanone|J1.059.487A|F2147-8949
| Molecular Formula | C12H8ClNO |
|---|---|
| Molecular Weight | 217.02943 g/mol |
| LogP | 2.966 |
| Topological Polar Surface Area | 29.96 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 217.02943 |
| Monoisotopic Mass | 217.02943 |
| Heavy Atoms | 15 |
| Complexity | 464.7406 |
Chemical Identifiers
| CAS Number | 79567-66-1 |
|---|---|
| SMILES | C1=CC=C(C=C1)C(=O)C2=CN=C(C=C2)Cl |
Product Overview
Methanone, (6-chloro-3-pyridinyl)phenyl- (CAS 79567-66-1), with molecular formula C12H8ClNO and molecular weight 217.02943 g/mol. IUPAC: (6-chloro-3-pyridinyl)-phenylmethanone.
Methanone, (6-chloro-3-pyridinyl)phenyl- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »