Ethyl 3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxo-propanoate
ethyl 3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxopropanoate
Also Known As: Propanoicacid,3-[[2- ethyl]amino]-3-oxo-,ethylester|ethyl 3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxo-propanoate|ethyl 3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxopropanoate|ethyl 2-{N-[2-(3,4-dimethoxyphenyl)ethyl]carbamoyl}acetate|ethyl 3-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-3-oxopropanoate|N-[2-(3,4-dimethoxyphenyl)ethyl]malonic acid ethyl ester amide|ethyl 2-{N-[2-(3,4-dimethoxyphenyl)-ethyl]-carbamoyl}-acetate|Propanoic acid,3-[[2-(3,4-dimethoxyphenyl)ethyl]amino]-3-oxo-,ethyl ester
| Molecular Formula | C15H21NO5 |
|---|---|
| Molecular Weight | 295.14197 g/mol |
| LogP | 1.3157 |
| Topological Polar Surface Area | 73.86 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Exact Mass | 295.14197 |
| Monoisotopic Mass | 295.14197 |
| Heavy Atoms | 21 |
| Complexity | 486.95236 |
Chemical Identifiers
| CAS Number | 79641-41-1 |
|---|---|
| SMILES | CCOC(=O)CC(=O)NCCC1=CC(=C(C=C1)OC)OC |
Product Overview
Ethyl 3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxo-propanoate (CAS 79641-41-1), with molecular formula C15H21NO5 and molecular weight 295.14197 g/mol. IUPAC: ethyl 3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxopropanoate.