![1-{2-[(2-chlorobenzyl)oxy]phenyl}-N-(tetrahydrofuran-2-ylmethyl)methanamine structure](/static/products/796/796887-69-9.png)
1-{2-[(2-chlorobenzyl)oxy]phenyl}-N-(tetrahydrofuran-2-ylmethyl)methanamine
N-[[2-[(2-chlorophenyl)methoxy]phenyl]methyl]-1-(oxolan-2-yl)methanamine
Also Known As: AN-465/42246838|1-{2-[(2-chlorobenzyl)oxy]phenyl}-N-(tetrahydrofuran-2-ylmethyl)methanamine|N-[[2-[(2-chlorophenyl)methoxy]phenyl]methyl]-1-(oxolan-2-yl)methanamine|({2-[(2-CHLOROPHENYL)METHOXY]PHENYL}METHYL)(OXOLAN-2-YLMETHYL)AMINE|N-{2-[(2-chlorobenzyl)oxy]benzyl}-N-(tetrahydro-2-furanylmethyl)amine
| Molecular Formula | C19H22ClNO2 |
|---|---|
| Molecular Weight | 331.1339 g/mol |
| LogP | 4.1876 |
| Topological Polar Surface Area | 30.49 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Exact Mass | 331.1339 |
| Monoisotopic Mass | 331.1339 |
| Heavy Atoms | 23 |
| Complexity | 626.2716 |
Chemical Identifiers
| CAS Number | 796887-69-9 |
|---|---|
| SMILES | C1CC(OC1)CNCC2=CC=CC=C2OCC3=CC=CC=C3Cl |
Product Overview
1-{2-[(2-chlorobenzyl)oxy]phenyl}-N-(tetrahydrofuran-2-ylmethyl)methanamine (CAS 796887-69-9), with molecular formula C19H22ClNO2 and molecular weight 331.1339 g/mol. IUPAC: N-[[2-[(2-chlorophenyl)methoxy]phenyl]methyl]-1-(oxolan-2-yl)methanamine.
1-{2-[(2-chlorobenzyl)oxy]phenyl}-N-(tetrahydrofuran-2-ylmethyl)methanamine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »