1-Propen-1-ol, 2-phenyl-, 1-acetate, (1E)-
[(E)-2-phenylprop-1-enyl] acetate
Also Known As: (E)-2-Phenylpropenyl acetate|2-Phenylpropenyl acetate|[(E)-2-phenylprop-1-enyl] acetate|2-phenylprop-1-enyl acetate|2-Phenyl-1(2)-propene-1-yl acetate|EINECS 253-735-6|2-phenylprop-1-en-1-yl acetate|2-Phenyl-1-propen-1-ol acetate|(E) - 2 - phenylpropenyl acetate|1-Propen-1-ol, 2-phenyl-, acetate, (E)-|(E)-2-Phenyl-1-propen-1-ol acetate|Acetic acid 2-phenyl-1-propenyl ester|(E)-2-Phenyl-1-propene-1-ol acetate|Acetic acid (E)-beta-methylstyryl ester|1-Propen-1-ol, 2-phenyl-, 1-acetate, (1E)-|(1E)-2-PHENYLPROP-1-EN-1-YL ACETATE|1-Propen-1-ol, 2-phenyl-, acetate, (1E)-|253-735-6
| Molecular Formula | C11H12O2 |
|---|---|
| Molecular Weight | 176.08372 g/mol |
| LogP | 2.6105 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 176.08372 |
| Monoisotopic Mass | 176.08372 |
| Heavy Atoms | 13 |
| Complexity | 312.12198 |
Chemical Identifiers
| CAS Number | 79809-21-5 |
|---|---|
| SMILES | C/C(=C\OC(=O)C)/C1=CC=CC=C1 |
Product Overview
1-Propen-1-ol, 2-phenyl-, 1-acetate, (1E)- (CAS 79809-21-5), with molecular formula C11H12O2 and molecular weight 176.08372 g/mol. IUPAC: [(E)-2-phenylprop-1-enyl] acetate.