AC1MVBAA
5-cyano-N-(4-fluorophenyl)-4-(furan-2-yl)-2-methyl-6-[2-(2-methylanilino)-2-oxoethyl]sulfanyl-1,4-dihydropyridine-3-carboxamide
Also Known As: 5-cyano-N-(4-fluorophenyl)-4-(furan-2-yl)-2-methyl-6-((2-oxo-2-(o-tolylamino)ethyl)thio)-1,4-dihydropyridine-3-carboxamide|5-cyano-N-(4-fluorophenyl)-4-(furan-2-yl)-2-methyl-6-({2-[(2-methylphenyl)amino]-2-oxoethyl}sulfanyl)-1,4-dihydropyridine-3-carboxamide|5-cyano-N-(4-fluorophenyl)-4-(furan-2-yl)-2-methyl-6-[2-(2-methylanilino)-2-oxoethyl]sulfanyl-1,4-dihydropyridine-3-carboxamide
| Molecular Formula | C27H23FN4O3S |
|---|---|
| Molecular Weight | 502.1475 g/mol |
| LogP | 5.4337 |
| Topological Polar Surface Area | 107.16 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Exact Mass | 502.1475 |
| Monoisotopic Mass | 502.1475 |
| Heavy Atoms | 36 |
| Complexity | 1389.1268 |
Chemical Identifiers
| CAS Number | 799792-75-9 |
|---|---|
| SMILES | CC1=CC=CC=C1NC(=O)CSC2=C(C(C(=C(N2)C)C(=O)NC3=CC=C(C=C3)F)C4=CC=CO4)C#N |
Product Overview
AC1MVBAA (CAS 799792-75-9), with molecular formula C27H23FN4O3S and molecular weight 502.1475 g/mol. IUPAC: 5-cyano-N-(4-fluorophenyl)-4-(furan-2-yl)-2-methyl-6-[2-(2-methylanilino)-2-oxoethyl]sulfanyl-1,4-dihydropyridine-3-carboxamide.