Rosmarinic Acid
(2R)-3-(3,4-dihydroxyphenyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoic acid
Also Known As: rosmarinic acid|Rosemary acid|Labiatenic acid|Rosmarinicacid|Rosmarinate|Labiatic acid|Rosmarimic acid|Rosmarinic-acid|Rosemaric acid|(R)-rosmarinic acid|Rosemarinic Acid|trans-Rosmarinic acid|rosmaric acid|Acid, Rosemary|Acid, Rosmarinic|Rosmarinic acid racemate|ORISTRACT ROA|Benzenepropanoic acid|Rosmarinic acid CRS|Rosmarinic acid, 2|Meiji Red Perilla Polyphenol|Rosmarinic acid, 96%|bmse000648|Rosmarinic acid (Standard)|RM 21A|RM-21A|(R)-(+)-Rosmarinic Acid|ROSMARINIC ACID [MI]|NPLC 0542|NPLC-0542|trans-1,4-Dichlorocyclohexane|ROSMARINIC ACID [HSDB]|MEGxp0_000163
| Molecular Formula | C18H16O8 |
|---|---|
| Molecular Weight | 360.0845 g/mol |
| LogP | 1.7613 |
| Topological Polar Surface Area | 144.52 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Exact Mass | 360.0845 |
| Monoisotopic Mass | 360.0845 |
| Heavy Atoms | 26 |
| Complexity | 856.2648 |
Chemical Identifiers
| CAS Number | 80225-53-2 |
|---|---|
| SMILES | C1=CC(=C(C=C1C[C@H](C(=O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O |
Product Overview
Rosmarinic Acid (CAS 80225-53-2), with molecular formula C18H16O8 and molecular weight 360.0845 g/mol. IUPAC: (2R)-3-(3,4-dihydroxyphenyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoic acid.