1,10alpha-Epoxy-8alpha-hydroxyachillin
5-hydroxy-3,7,12-trimethyl-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-ene-8,14-dione
Also Known As: 1,10alpha-Epoxy-8alpha-hydroxyachillin|3H-Oxireno(8,8a)azuleno(4,5-b)furan-3,8(4aH)-dione, 5,6,6a,7,9a,9b-hexahydro-6-hydroxy-1,4a,7-trimethyl-, (4aR-(3aS*,4aalpha,6beta,6abeta,7alpha,9aalpha,9bbeta))-|6-Hydroxy-1,4a,7-trimethyl-5,6,6a,7,9a,9b-hexahydro-3H-oxireno[8,8a]azuleno[4,5-b]furan-3,8(4aH)-dione
| Molecular Formula | C15H18O5 |
|---|---|
| Molecular Weight | 278.11542 g/mol |
| LogP | 0.1 |
| Topological Polar Surface Area | 76.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 0 |
| Exact Mass | 278.11542 |
| Monoisotopic Mass | 278.11542 |
| Heavy Atoms | 20 |
| Complexity | 567.0 |
Chemical Identifiers
| CAS Number | 80876-77-3 |
|---|---|
| SMILES | CC1C2C(CC3(C4(O3)C(C2OC1=O)C(=CC4=O)C)C)O |
| InChIKey | RGIRICBYSPMPGI-UHFFFAOYSA-N |
Product Overview
1,10alpha-Epoxy-8alpha-hydroxyachillin (CAS 80876-77-3), with molecular formula C15H18O5 and molecular weight 278.11542 g/mol. IUPAC: 5-hydroxy-3,7,12-trimethyl-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-ene-8,14-dione.
1,10alpha-Epoxy-8alpha-hydroxyachillin is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »