1-Amino-4-bromoanthraquinone
1-amino-4-bromoanthracene-9,10-dione
Also Known As: 1-Amino-4-bromo anthraquinone|1-Amino-4-bromoanthraquinone|1-amino-4-bromoanthracene-9,10-dione|glimepiride|1-Amino-4-bromo-anthraquinone|9,10-Anthracenedione, 1-amino-4-bromo-|1-amino-4-bromo-9,10-anthraquinone|4664AH|1-Amino-4-bromoanthra-9,10-quinone|1-amino-4-bromo-anthracene-9,10-dione|1-Amino-4-bromoanthra-9,10-quinone #|9,10-Anthracenedione,1-amino-4-bromo-|BAS 00415589|1-azanyl-4-bromanyl-anthracene-9,10-dione|081A629|I08-1402|SR-01000314382-1|1-AMINO-4-BROMO-9,10-DIHYDROANTHRACENE-9,10-DIONE|622-058-1
| Molecular Formula | C14H8BrNO2 |
|---|---|
| Molecular Weight | 300.97385 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 60.2 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 0 |
| Exact Mass | 300.97385 |
| Monoisotopic Mass | 300.97385 |
| Heavy Atoms | 18 |
| Complexity | 384.0 |
Chemical Identifiers
| CAS Number | 81-62-9 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C=CC(=C3C2=O)Br)N |
| InChIKey | JOVRIPGYHSRFFR-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 11 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1-Amino-4-bromoanthraquinone (CAS 81-62-9), with molecular formula C14H8BrNO2 and molecular weight 300.97385 g/mol. IUPAC: 1-amino-4-bromoanthracene-9,10-dione.