Red Violet 2RN Acid Anthraquinone
1-anilino-9,10-dioxoanthracene-2-carboxylic acid
Also Known As: Red Violet 2RN Acid Anthraquinone|1-Anilino-9,10-dioxo-2-anthroic acid|1-anilino-9,10-dioxoanthracene-2-carboxylic acid|2-Anthroic acid,10-dihydro-9,10-dioxo-|AG-690/10484034|9,10-dioxo-1-(phenylamino)-9,10-dihydroanthracene-2-carboxylic acid|1-anilino-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid|9,10-Dihydro-9,10-dioxo-1-(phenylamino)-2-anthracenecarboxylic acid|1-anilino-9,10-dioxo-9,10-dihydroanthracene-2-carboxylic acid|2-Anthracenecarboxylic acid,10-dihydro-9,10-dioxo-1-(phenylamino)-|2-Anthracenecarboxylic acid, 9,10-dihydro-9,10-dioxo-1-(phenylamino)-
| Molecular Formula | C21H13NO4 |
|---|---|
| Molecular Weight | 343.08447 g/mol |
| LogP | 4.5 |
| Topological Polar Surface Area | 83.5 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 343.08447 |
| Monoisotopic Mass | 343.08447 |
| Heavy Atoms | 26 |
| Complexity | 583.0 |
Chemical Identifiers
| CAS Number | 81-79-8 |
|---|---|
| SMILES | C1=CC=C(C=C1)NC2=C(C=CC3=C2C(=O)C4=CC=CC=C4C3=O)C(=O)O |
| InChIKey | GNYBNEOJUARKPW-UHFFFAOYSA-N |
Product Overview
Red Violet 2RN Acid Anthraquinone (CAS 81-79-8), with molecular formula C21H13NO4 and molecular weight 343.08447 g/mol. IUPAC: 1-anilino-9,10-dioxoanthracene-2-carboxylic acid.