3-ethyl-4-[(E)-9-hydroxy-4,6,8,10-tetramethyl-7-oxododec-4-en-2-yl]oxetan-2-one
3-ethyl-4-[(E)-9-hydroxy-4,6,8,10-tetramethyl-7-oxododec-4-en-2-yl]oxetan-2-one
Also Known As: EBELACTONE B|EBELACTONEB|UPCMLD-DP117|UPCMLD-DP117:001|UPCMLD-DP117:002|SMP2_000167|G-223|3-ethyl-4-[(E)-9-hydroxy-4,6,8,10-tetramethyl-7-oxododec-4-en-2-yl]oxetan-2-one|3-ethyl-4-(9-hydroxy-4,6,8,10-tetramethyl-7-oxododec-4-en-2-yl)oxetan-2-one|2-Ethyl-3,11-dihydroxy-4,6,8,10,12-pentamethyl-9-oxo-6-tetradecenoic acid 1,3-lactone|2-ethyl-3,11-dihydroxy-4,6,8,10,12-pentamethyl-9-oxo-tetradecenoic 1,3-lactone
| Molecular Formula | C21H36O4 |
|---|---|
| Molecular Weight | 352.26135 g/mol |
| LogP | 4.1588 |
| Topological Polar Surface Area | 63.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Exact Mass | 352.26135 |
| Monoisotopic Mass | 352.26135 |
| Heavy Atoms | 25 |
| Complexity | 496.1245 |
Chemical Identifiers
| CAS Number | 81036-52-4 |
|---|---|
| SMILES | CCC1C(OC1=O)C(C)C/C(=C/C(C)C(=O)C(C)C(C(C)CC)O)/C |
Product Overview
3-ethyl-4-[(E)-9-hydroxy-4,6,8,10-tetramethyl-7-oxododec-4-en-2-yl]oxetan-2-one (CAS 81036-52-4), with molecular formula C21H36O4 and molecular weight 352.26135 g/mol. IUPAC: 3-ethyl-4-[(E)-9-hydroxy-4,6,8,10-tetramethyl-7-oxododec-4-en-2-yl]oxetan-2-one.