4'-Phenoxyacetophenone
1-(4-phenoxyphenyl)ethanone
Also Known As: 4'-Phenoxyacetophenone|1-(4-Phenoxyphenyl)ethanone|4-Phenoxyacetophenone|p-Phenoxyacetophenone|4-Acetyldiphenyl Ether|1-(4-phenoxyphenyl)ethan-1-one|3-fluoro-2-butanone|Ethanone, 1-(4-phenoxyphenyl)-|1-(4-phenoxyphenyl)ethanon|4-Acetyldiphenyl oxide|ACMC-1AYBK|4 -Phenoxyacetophenone|1-acetyl-4-phenoxybenzene|4-Acetylphenyl phenyl ether|trans-2-HEXENYLBUTYRATE|Ethanone,1-(4-phenoxyphenyl)-|4'-Phenoxyacetophenone|1-(4-phenoxyphenyl)-1-ethanone|4'-Phenoxyacetophenone, 98%|1,2-(4-Acetylphenoxy)benzene|1-(4-phenoxy-phenyl)-ethanone|1-(4-Phenoxyphenyl)ethanone #|KST-1B5320|6894AB|CK2558
| Molecular Formula | C14H12O2 |
|---|---|
| Molecular Weight | 212.08372 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 212.08372 |
| Monoisotopic Mass | 212.08372 |
| Heavy Atoms | 16 |
| Complexity | 223.0 |
Chemical Identifiers
| CAS Number | 814-79-9 |
|---|---|
| SMILES | CC(=O)C1=CC=C(C=C1)OC2=CC=CC=C2 |
| InChIKey | DJNIFZYQFLFGDT-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 12 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4'-Phenoxyacetophenone (CAS 814-79-9), with molecular formula C14H12O2 and molecular weight 212.08372 g/mol. IUPAC: 1-(4-phenoxyphenyl)ethanone.