1-((5-Bromo-2-thienyl)sulfonyl)piperidine
1-(5-bromothiophen-2-yl)sulfonylpiperidine
Also Known As: 1-[(5-Bromo-2-thienyl)sulfonyl]piperidine|1-(5-bromothiophen-2-yl)sulfonylpiperidine|1-[(5-bromothiophen-2-yl)sulfonyl]piperidine|1-(5-bromo-2-thienylsulfonyl)piperidine|5-bromo-2-(piperidylsulfonyl)thiophene|1-(5-Bromo-thiophene-2-sulfonyl)-piperidine|1-(5-Bromothiophene-2-sulfonyl)piperidine|1-((5-Bromo-2-thienyl)sulfonyl)piperidine|1-(5-Bromothiophen-2-ylsulfonyl)piperidine|Piperidine, 1-[(5-bromo-2-thienyl)sulfonyl]-|BB 0242842|1-((5-bromothiophen-2-yl)sulfonyl)piperidine|1-[(5-Bromo-2-thienyl)sulfonyl]piperidine #|AO-080/40883021|SR-01000534948-1|F6548-0500|A2642/0112506
| Molecular Formula | C9H12BrNO2S2 |
|---|---|
| Molecular Weight | 308.94928 g/mol |
| LogP | 3.0 |
| Topological Polar Surface Area | 74.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 308.94928 |
| Monoisotopic Mass | 308.94928 |
| Heavy Atoms | 15 |
| Complexity | 309.0 |
Chemical Identifiers
| CAS Number | 81597-71-9 |
|---|---|
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC=C(S2)Br |
| InChIKey | JOPVDBGGIVPTLH-UHFFFAOYSA-N |
Product Overview
1-((5-Bromo-2-thienyl)sulfonyl)piperidine (CAS 81597-71-9), with molecular formula C9H12BrNO2S2 and molecular weight 308.94928 g/mol. IUPAC: 1-(5-bromothiophen-2-yl)sulfonylpiperidine.
1-((5-Bromo-2-thienyl)sulfonyl)piperidine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »