5H-Pyrazino(2,3-d)azepin-2-amine, 6,7,8,9-tetrahydro-7-ethyl-, dihydrochloride
7-ethyl-5,6,8,9-tetrahydropyrazino[2,3-d]azepin-3-amine;dihydrochloride
Also Known As: 5H-Pyrazino(2,3-d)azepin-2-amine, 6,7,8,9-tetrahydro-7-ethyl-, dihydrochloride|6,7,8,9-Tetrahydro-7-ethyl-5H-pyrazino(2,3-d)azepin-2-amine dihydrochloride|7-Ethyl-2-amino-6,7,8,9-tetrahydro-5H-pyrazino(2,3-d)azepine dihydrochloride|7-ethyl-5,6,8,9-tetrahydropyrazino[2,3-d]azepin-3-amine dihydrochloride|5H-Pyrazino[2,3-d]azepin-2-amine,7-ethyl-6,7,8,9-tetrahydro-, hydrochloride (1:2)|7-Ethyl-6,7,8,9-tetrahydro-5H-pyrazino[2,3-d]azepin-2-amine--hydrogen chloride (1/2)
| Molecular Formula | C10H18Cl2N4 |
|---|---|
| Molecular Weight | 264.09085 g/mol |
| LogP | 1.3229 |
| Topological Polar Surface Area | 55.04 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 264.09085 |
| Monoisotopic Mass | 264.09085 |
| Heavy Atoms | 16 |
| Complexity | 332.59512 |
Chemical Identifiers
| CAS Number | 82102-74-7 |
|---|---|
| SMILES | CCN1CCC2=NC=C(N=C2CC1)N.Cl.Cl |
Product Overview
5H-Pyrazino(2,3-d)azepin-2-amine, 6,7,8,9-tetrahydro-7-ethyl-, dihydrochloride (CAS 82102-74-7), with molecular formula C10H18Cl2N4 and molecular weight 264.09085 g/mol. IUPAC: 7-ethyl-5,6,8,9-tetrahydropyrazino[2,3-d]azepin-3-amine;dihydrochloride.