2,4,6-Cycloheptatrien-1-one, 2,2'-thiobis(7-hydroxy-
2-hydroxy-3-(2-hydroxy-3-oxocyclohepta-1,4,6-trien-1-yl)sulfanylcyclohepta-2,4,6-trien-1-one
Also Known As: Ditropolonyl sulfide|DITROPOLONYL SULPHIDE|2,4,6-Cycloheptatrien-1-one, 2,2'-thiobis(7-hydroxy-|Bis(3-hydroxy-2-oxocycloheptatrien-(3,5,7)-yl)sulfide|2,2 -Thiobis(7-hydroxy-2,4,6-cycloheptatrien-1-one)|2-hydroxy-3-(2-hydroxy-3-oxocyclohepta-1,4,6-trien-1-yl)sulfanylcyclohepta-2,4,6-trien-1-one|3,3'-Sulfanediylbis(2-hydroxycyclohepta-2,4,6-trien-1-one)|2-hydroxy-7-[(6-hydroxy-7-oxocyclohepta-1,3,5-trien-1-yl)sulfanyl]cyclohepta-2,4,6-trien-1-one
| Molecular Formula | C14H10O4S |
|---|---|
| Molecular Weight | 274.02997 g/mol |
| LogP | 1.9694 |
| Topological Polar Surface Area | 74.6 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Exact Mass | 274.02997 |
| Monoisotopic Mass | 274.02997 |
| Heavy Atoms | 19 |
| Complexity | 665.4749 |
Chemical Identifiers
| CAS Number | 82131-75-7 |
|---|---|
| SMILES | C1=CC(=C(C(=O)C=C1)O)SC2=C(C(=O)C=CC=C2)O |
Product Overview
2,4,6-Cycloheptatrien-1-one, 2,2'-thiobis(7-hydroxy- (CAS 82131-75-7), with molecular formula C14H10O4S and molecular weight 274.02997 g/mol. IUPAC: 2-hydroxy-3-(2-hydroxy-3-oxocyclohepta-1,4,6-trien-1-yl)sulfanylcyclohepta-2,4,6-trien-1-one.