Acetic acid, ester with N-(1-hydroxy-2,2,2-trichloroethyl)benzenesulfonamide
[1-(benzenesulfonamido)-2,2,2-trichloroethyl] acetate
Also Known As: N-(1-Acetoxy-2,2,2-trichloroethyl)benzenesulfonamide|4-11-00-00056 (Beilstein Handbook Reference)|Benzenesulfonamide, N-(1-(acetyloxy)-2,2,2-trichloroethyl)-|[1-(benzenesulfonamido)-2,2,2-trichloroethyl] acetate|Acetic acid, ester with N-(1-hydroxy-2,2,2-trichloroethyl)benzenesulfonamide|1-(Benzenesulfonamido)-2,2,2-trichloroethyl acetate|1-[(Benzenesulfonyl)amino]-2,2,2-trichloroethyl acetate|N-(1-Acetyloxy-2,2,2-trichloroethyl)benzenesulfonamide|1-BENZENESULFONAMIDO-2,2,2-TRICHLOROETHYL ACETATE
| Molecular Formula | C10H10Cl3NO4S |
|---|---|
| Molecular Weight | 344.9396 g/mol |
| LogP | 2.2243 |
| Topological Polar Surface Area | 72.47 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 344.9396 |
| Monoisotopic Mass | 344.9396 |
| Heavy Atoms | 19 |
| Complexity | 541.64325 |
Chemical Identifiers
| CAS Number | 83191-20-2 |
|---|---|
| SMILES | CC(=O)OC(C(Cl)(Cl)Cl)NS(=O)(=O)C1=CC=CC=C1 |
Product Overview
Acetic acid, ester with N-(1-hydroxy-2,2,2-trichloroethyl)benzenesulfonamide (CAS 83191-20-2), with molecular formula C10H10Cl3NO4S and molecular weight 344.9396 g/mol. IUPAC: [1-(benzenesulfonamido)-2,2,2-trichloroethyl] acetate.