Ebracteolata compound B
1-(2,4-dihydroxy-6-methoxy-3-methylphenyl)ethanone
Also Known As: Ebracteolata cpd B|EbracteolatacpdB|Ebracteolata compound B|1-(2,4-dihydroxy-6-methoxy-3-methylphenyl)ethanone|2,4-Dihydroxy-6-methoxy-3-methylacetophenone|2,4Dihydroxy6methoxy3methylacetophenone|HY-N7893|7994AH|NP4681|TN3909|FS-8054|2, 4-Dihydroxy-6-methoxy-3-methyl-acetophenone|1-(2,4-Dihydroxy-6-methoxy-3-methylphenyl)ethan-1-one|Ethanone, 1-(2,4-dihydroxy-6-methoxy-3-methylphenyl)-|J1.062.796F|2,4 -Dihydroxy-6-methoxy-3-methylacetophenone|2,4-dihydroxy-6-methoxy-3-methyl-acetophenone|2-Methyl-5-methoxy-6-acetylbenzene-1,3-diol|AK-087/41104739|2 ,4 -Dihydroxy-3 -methyl-6 -methoxyacetophenone|2 ,4 -Dihydroxy-6 -methoxy-3 -methylacetophenone
| Molecular Formula | C10H12O4 |
|---|---|
| Molecular Weight | 196.07356 g/mol |
| LogP | 1.61742 |
| Topological Polar Surface Area | 66.76 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 196.07356 |
| Monoisotopic Mass | 196.07356 |
| Heavy Atoms | 14 |
| Complexity | 382.19867 |
Chemical Identifiers
| CAS Number | 83459-37-4 |
|---|---|
| SMILES | CC1=C(C(=C(C=C1O)OC)C(=O)C)O |
Product Overview
Ebracteolata compound B (CAS 83459-37-4), with molecular formula C10H12O4 and molecular weight 196.07356 g/mol. IUPAC: 1-(2,4-dihydroxy-6-methoxy-3-methylphenyl)ethanone.
Ebracteolata compound B is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »