Ethanone, 1-(4-(4-(methylsulfonyl)phenoxy)phenyl)-
1-[4-(4-methylsulfonylphenoxy)phenyl]ethanone
Also Known As: 1-[4-(4-methylsulfonylphenoxy)phenyl]ethanone|Ethanone, 1-(4-(4-(methylsulfonyl)phenoxy)phenyl)-|1-[4-[4-(METHYLSULFONYL)PHENOXY]PHENYL]-ETHANONE|1-(4-(4-(methylsulfonyl)phenoxy)phenyl)ethanone|1-[4-[4-(methylsulfonyl)phenoxy]phenyl]ethanone|Ethanone, 1-[4-[4-(methylsulfonyl)phenoxy]phenyl|A1-05684|1-{4-[4-(Methanesulfonyl)phenoxy]phenyl}ethan-1-one|Ethanone, 1-[4-[4-(methylsulfonyl)phenoxy]phenyl]-|2,3,6,7-Tetrahydro-3,7-dimethyl-2,6-dioxo-1H-purine-1-butanoic Acid Ethyl Ester
| Molecular Formula | C15H14O4S |
|---|---|
| Molecular Weight | 290.06128 g/mol |
| LogP | 2.4 |
| Topological Polar Surface Area | 68.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 290.06128 |
| Monoisotopic Mass | 290.06128 |
| Heavy Atoms | 20 |
| Complexity | 421.0 |
Chemical Identifiers
| CAS Number | 83642-22-2 |
|---|---|
| SMILES | CC(=O)C1=CC=C(C=C1)OC2=CC=C(C=C2)S(=O)(=O)C |
| InChIKey | CUDIIGGMJHXZLC-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Ethanone, 1-(4-(4-(methylsulfonyl)phenoxy)phenyl)- (CAS 83642-22-2), with molecular formula C15H14O4S and molecular weight 290.06128 g/mol. IUPAC: 1-[4-(4-methylsulfonylphenoxy)phenyl]ethanone.