Brl 26314
(2S)-2-[(4-chlorophenyl)methylamino]-3-phenylpropanoic acid
Also Known As: Brl 26314|Brl-26314|N-(4-Chlorobenzyl)phenylalanine|N-(para-Chlorobenzyl)-L-phenylalanine|n-(4-chlorobenzyl)-l-phenylalanine|(4-chlorobenzyl)-L-phenylalanine|N-[(4-Chlorophenyl)methyl]phenylalanine|L-Phenylalanine, N-((4-chlorophenyl)methyl)-|N-[(4-Chlorophenyl)methyl]-L-phenylalanine|(2S)-2-[(4-chlorophenyl)methylamino]-3-phenylpropanoic acid
| Molecular Formula | C16H16ClNO2 |
|---|---|
| Molecular Weight | 289.08694 g/mol |
| LogP | 0.6 |
| Topological Polar Surface Area | 49.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Exact Mass | 289.08694 |
| Monoisotopic Mass | 289.08694 |
| Heavy Atoms | 20 |
| Complexity | 297.0 |
Chemical Identifiers
| CAS Number | 838-41-5 |
|---|---|
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NCC2=CC=C(C=C2)Cl |
| InChIKey | SAOHCSVJQIAGDD-HNNXBMFYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Brl 26314 (CAS 838-41-5), with molecular formula C16H16ClNO2 and molecular weight 289.08694 g/mol. IUPAC: (2S)-2-[(4-chlorophenyl)methylamino]-3-phenylpropanoic acid.
Brl 26314 is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »