2,3-Dichloroanthraquinone
2,3-dichloroanthracene-9,10-dione
Also Known As: 2,3-Dichloroanthraquinone|2,3-dichloroanthracene-9,10-dione|2,10-anthraquinone|2,3-dichloranthrachinon|9, 2,3-dichloro-|2,3-Dichlor-anthrachinon|Anthraquinone,3-dichloro-|2,3-Dichloro-9,10-anthraquinone|Anthraquinone, 2,3-dichloro-|2,3-Dichloroanthra-9,10-quinone|9,10-Anthracenedione,2,3-dichloro-|2,3-dichloro-9,10-anthracenedione|9,10-Anthracenedione, 2,3-dichloro-|2,3-Dichloroanthra-9,10-quinone #|2,3-DICHLORO-9,10-DIHYDROANTHRACENE-9,10-DIONE|F0051-0092|5-Ethyl-2-hydroxy-3-methylcyclopent-2-en-1-one|AH-034/32829021
| Molecular Formula | C14H6Cl2O2 |
|---|---|
| Molecular Weight | 275.9745 g/mol |
| LogP | 4.6 |
| Topological Polar Surface Area | 34.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 0 |
| Exact Mass | 275.9745 |
| Monoisotopic Mass | 275.9745 |
| Heavy Atoms | 18 |
| Complexity | 346.0 |
Chemical Identifiers
| CAS Number | 84-45-7 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C=C3C2=O)Cl)Cl |
| InChIKey | KPYPNTLKDIYIKB-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2,3-Dichloroanthraquinone (CAS 84-45-7), with molecular formula C14H6Cl2O2 and molecular weight 275.9745 g/mol. IUPAC: 2,3-dichloroanthracene-9,10-dione.