diallylisopropylidenebis
[4-[2-(4-prop-2-enoxycarbonyloxyphenyl)propan-2-yl]phenyl] prop-2-enyl carbonate
Also Known As: diallylisopropylidenebis|Diallyl isopropylidenebis(p-phenylenecarbonate)|2,2-Bis[4-(allyloxycarbonyloxy)phenyl]propane|Carbonic acid, (1-methylethylidene)di-4,1-phenylene di-2-propenyl ester|Carbonic acid, C,C'-((1-methylethylidene)di-4,1-phenylene) C,C'-di-2-propen-1-yl ester|[4-[2-(4-prop-2-enoxycarbonyloxyphenyl)propan-2-yl]phenyl] prop-2-enyl carbonate|(Propane-2,2-diyl)di(4,1-phenylene) di(prop-2-en-1-yl) biscarbonate|Carbonic acid, C,C'-[(1-methylethylidene)di-4,1-phenylene] C,C'-di-2-propen-1-yl ester|PROP-2-EN-1-YL 4-[2-(4-{[(PROP-2-EN-1-YLOXY)CARBONYL]OXY}PHENYL)PROPAN-2-YL]PHENYL CARBONATE
| Molecular Formula | C23H24O6 |
|---|---|
| Molecular Weight | 396.1573 g/mol |
| LogP | 6.3 |
| Topological Polar Surface Area | 71.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Exact Mass | 396.1573 |
| Monoisotopic Mass | 396.1573 |
| Heavy Atoms | 29 |
| Complexity | 506.0 |
Chemical Identifiers
| CAS Number | 84000-75-9 |
|---|---|
| SMILES | CC(C)(C1=CC=C(C=C1)OC(=O)OCC=C)C2=CC=C(C=C2)OC(=O)OCC=C |
| InChIKey | SZYLPVRUCVUHGB-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
diallylisopropylidenebis (CAS 84000-75-9), with molecular formula C23H24O6 and molecular weight 396.1573 g/mol. IUPAC: [4-[2-(4-prop-2-enoxycarbonyloxyphenyl)propan-2-yl]phenyl] prop-2-enyl carbonate.