Methyl 5-bromo-1-benzofuran-2-carboxylate
methyl 5-bromo-1-benzofuran-2-carboxylate
Also Known As: methyl 5-bromobenzofuran-2-carboxylate|Methyl 5-bromo-1-benzofuran-2-carboxylate|5-Bromobenzofuran-2-carboxylic acid methyl ester|CANTHARIDICACID|5-Bromo-benzofuran-2-carboxylic acid methyl ester|2-BENZOFURANCARBOXYLIC ACID, 5-BROMO-, METHYL ESTER|2208AB|methyl5-bromobenzofuran-2-carboxylate|5-Bromo-2-benzofurancarboxylic Acid Methyl Ester|Methyl 5-bromobenzo[b]furan-2-carboxylate|methyl 5-bromobenzo[d]furan-2-carboxylate|FH-0731|KS-0000255J|Methyl 5-bromo-1-benzofuran-2-carboxylate #|5-BROMOBENZOFURAN-2-CARBOXYLICACIDMETHYLESTER
| Molecular Formula | C10H7BrO3 |
|---|---|
| Molecular Weight | 253.95786 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 39.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 253.95786 |
| Monoisotopic Mass | 253.95786 |
| Heavy Atoms | 14 |
| Complexity | 231.0 |
Chemical Identifiers
| CAS Number | 84102-69-2 |
|---|---|
| SMILES | COC(=O)C1=CC2=C(O1)C=CC(=C2)Br |
| InChIKey | ZZDBMDNRQQDSKG-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methyl 5-bromo-1-benzofuran-2-carboxylate (CAS 84102-69-2), with molecular formula C10H7BrO3 and molecular weight 253.95786 g/mol. IUPAC: methyl 5-bromo-1-benzofuran-2-carboxylate.