1-Chloro-3-fluoro-2-(trichloromethyl)benzene
1-chloro-3-fluoro-2-(trichloromethyl)benzene
Also Known As: 2-Chloro-6-fluorobenzotrichloride|1-Chloro-3-fluoro-2-(trichloromethyl)benzene|EINECS 282-938-2|N-methyl-3-phenylmethoxybenzamide|ISO-METHYLTETRAHYDROIONYLACETATE|alpha,alpha,alpha,2-Tetrachloro-6-fluorotoluene|3-chloro-1-fluoro-2-(trichloromethyl)benzene|alpha,alpha,alpha,6-Tetrachloro-2-fluorotoluene|1-Chloro-3-fluoro-2-(trichloromethyl)benzene #|Benzene,1-chloro-3-fluoro-2-(trichloromethyl)-|Benzene, 1-chloro-3-fluoro-2-(trichloromethyl)-|282-938-2
| Molecular Formula | C7H3Cl4F |
|---|---|
| Molecular Weight | 245.8973 g/mol |
| LogP | 4.3 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 0 |
| Exact Mass | 245.8973 |
| Monoisotopic Mass | 245.8973 |
| Heavy Atoms | 12 |
| Complexity | 156.0 |
Chemical Identifiers
| CAS Number | 84475-45-6 |
|---|---|
| SMILES | C1=CC(=C(C(=C1)Cl)C(Cl)(Cl)Cl)F |
| InChIKey | PNAGDDZKFJHOOK-UHFFFAOYSA-N |
Product Overview
1-Chloro-3-fluoro-2-(trichloromethyl)benzene (CAS 84475-45-6), with molecular formula C7H3Cl4F and molecular weight 245.8973 g/mol. IUPAC: 1-chloro-3-fluoro-2-(trichloromethyl)benzene.
1-Chloro-3-fluoro-2-(trichloromethyl)benzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »