4,4'-Diamino-2,2'-dibromobiphenyl
4-(4-amino-2-bromophenyl)-3-bromoaniline
Also Known As: 4,4'-Diamino-2,2'-dibromobiphenyl|4-(4-amino-2-bromophenyl)-3-bromoaniline|2,2''-dibromo-benzidine|2,2 -Dibromobenzidine|4,4-Diamino-2,2-dibromobiphenyl|KS-000009XP|2,2'-dibromo-4,4'-diaminobiphenyl|6021AJ|4-(4-amino-2-bromo-phenyl)-3-bromo-aniline|[1,1'-Biphenyl]-4,4'-diamine, 2,2'-dibromo-|2,2'-DIBROMO-[1,1'-BIPHENYL]-4,4'-DIAMINE|Z-3641|[1,1'-Biphenyl]-4,4'-diamine,2,2'-dibromo-|2,2 -Dibromo-1,1 -biphenyl-4,4 -diamine|4,4 inverted exclamation mark -Diamino-2,2 inverted exclamation mark -dibromobiphenyl|4 pound not4 inverted exclamation mark -Diamino-2 pound not2 inverted exclamation mark -dibromobiphenyl
| Molecular Formula | C12H10Br2N2 |
|---|---|
| Molecular Weight | 339.92108 g/mol |
| LogP | 4.043 |
| Topological Polar Surface Area | 52.04 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 339.92108 |
| Monoisotopic Mass | 341.919 |
| Heavy Atoms | 16 |
| Complexity | 489.0371 |
Chemical Identifiers
| CAS Number | 84530-60-9 |
|---|---|
| SMILES | C1=CC(=C(C=C1N)Br)C2=C(C=C(C=C2)N)Br |
Product Overview
4,4'-Diamino-2,2'-dibromobiphenyl (CAS 84530-60-9), with molecular formula C12H10Br2N2 and molecular weight 339.92108 g/mol. IUPAC: 4-(4-amino-2-bromophenyl)-3-bromoaniline.