Tetrahydropseudocodeine
(1R,9R,10R,11S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,11-diol
Also Known As: Tetrahydropseudocodeine|Pseudocodeine, tetrahydro-|Allopseudocodeine, tetrahydro-|Morphinan-4,8-beta-diol, 3-methoxy-17-methyl-|3-Methoxy-17-methylmorphinan-4,8beta-diol|Morphinan-4,8-diol, 3-methoxy-17-methyl-, (8.beta.)-|Linksdrehende niedrigerschmelzende Form von 3-Methoxy-17-methyl-morphinan-4,8-diol|(1R,9R,10R,11S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-3,11-diol
| Molecular Formula | C18H25NO3 |
|---|---|
| Molecular Weight | 303.18344 g/mol |
| LogP | 2.0598 |
| Topological Polar Surface Area | 52.93 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 303.18344 |
| Monoisotopic Mass | 303.18344 |
| Heavy Atoms | 22 |
| Complexity | 602.24023 |
Chemical Identifiers
| CAS Number | 847-85-8 |
|---|---|
| SMILES | CN1CC[C@]23CCC[C@@H]([C@H]2[C@H]1CC4=C3C(=C(C=C4)OC)O)O |
Product Overview
Tetrahydropseudocodeine (CAS 847-85-8), with molecular formula C18H25NO3 and molecular weight 303.18344 g/mol. IUPAC: (1R,9R,10R,11S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,11-diol.