1-chloro-4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]benzene
1-chloro-4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]benzene
Also Known As: J2.786.703K|J3.091.704I|1-(4-Methoxyphenyl)-3-(4-chlorophenyl)-1-propene|1-chloro-4-[3-(4-methoxyphenyl)prop-2-en-1-yl]benzene|(E)-1-(4-Methoxyphenyl)-3-(4-chlorophenyl)-1-propene|1-[3-(4-chlorophenyl)prop-1-en-1-yl]-4-methoxybenzene|1-chloro-4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]benzene|1-[(1E)-3-(4-chlorophenyl)prop-1-en-1-yl]-4-methoxybenzene
| Molecular Formula | C16H15ClO |
|---|---|
| Molecular Weight | 258.08115 g/mol |
| LogP | 4.6045 |
| Topological Polar Surface Area | 9.23 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Exact Mass | 258.08115 |
| Monoisotopic Mass | 258.08115 |
| Heavy Atoms | 18 |
| Complexity | 511.79816 |
Chemical Identifiers
| CAS Number | 85248-83-5 |
|---|---|
| SMILES | COC1=CC=C(C=C1)/C=C/CC2=CC=C(C=C2)Cl |
Product Overview
1-chloro-4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]benzene (CAS 85248-83-5), with molecular formula C16H15ClO and molecular weight 258.08115 g/mol. IUPAC: 1-chloro-4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]benzene.
1-chloro-4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]benzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »