(2-Chloro-4-fluorophenyl)acetic acid methyl ester
methyl 2-(2-chloro-4-fluorophenyl)acetate
Also Known As: methyl 2-(2-chloro-4-fluorophenyl)acetate|Methyl 2-chloro-4-fluorophenylacetate|AMY6567|KS-00000P4A|METHYL 2-CHLORO-4-FLUOROPHENYLACETATE 98|methyl (2-chloro-4-fluorophenyl)acetate|Methyl-2-Chloro-4-Fluorophenylacetate|Methyl2-(2-chloro-4-fluorophenyl)acetate|methyl(2-chloro-4-fluorophenyl)acetate|(2-Chloro-4-fluorophenyl)acetic acid methyl ester|Benzeneacetic acid, 2-chloro-4-fluoro-, methyl ester|2-chloro-4-fluorophenylacetic acid methyl ester|S-3380|2-chloro-4-fluorobenzeneacetic acid methyl ester|Benzeneacetic acid,2-chloro-4-fluoro-, methyl ester
| Molecular Formula | C9H8ClFO2 |
|---|---|
| Molecular Weight | 202.01968 g/mol |
| LogP | 2.4 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 202.01968 |
| Monoisotopic Mass | 202.01968 |
| Heavy Atoms | 13 |
| Complexity | 186.0 |
Chemical Identifiers
| CAS Number | 853301-97-0 |
|---|---|
| SMILES | COC(=O)CC1=C(C=C(C=C1)F)Cl |
| InChIKey | DFTYYBRLWCAUHP-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(2-Chloro-4-fluorophenyl)acetic acid methyl ester (CAS 853301-97-0), with molecular formula C9H8ClFO2 and molecular weight 202.01968 g/mol. IUPAC: methyl 2-(2-chloro-4-fluorophenyl)acetate.
(2-Chloro-4-fluorophenyl)acetic acid methyl ester is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »