8-Methylnonyl phenylmethyl phthalate
2-O-benzyl 1-O-(8-methylnonyl) benzene-1,2-dicarboxylate
Also Known As: 8-Methylnonyl phenylmethyl phthalate|EINECS 287-156-5|Isodecyl alcohol, benzyl phthalate|8-METHYLNONYL BENZYL PHTHALATE|Benzyl 8-methylnonyl benzene-1,2-dicarboxylate|phthalic acid benzyl ester-(8-methyl-nonyl ester)|2-O-benzyl 1-O-(8-methylnonyl) benzene-1,2-dicarboxylate|1-benzyl 2-(8-methylnonyl) benzene-1,2-dicarboxylate|1,2-Benzenedicarboxylic acid, 8-methylnonyl phenylmethyl ester|1-(8-Methylnonyl) 2-(phenylmethyl) 1,2-benzenedicarboxylate|1,2-Benzenedicarboxylic acid 1-(8-methylnonyl)2-phenylmethyl ester|1,2-Benzenedicarboxylic acid, 1-(8-methylnonyl) 2-(phenylmethyl) ester
| Molecular Formula | C25H32O4 |
|---|---|
| Molecular Weight | 396.23007 g/mol |
| LogP | 6.197 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Exact Mass | 396.23007 |
| Monoisotopic Mass | 396.23007 |
| Heavy Atoms | 29 |
| Complexity | 752.42847 |
Chemical Identifiers
| CAS Number | 85409-84-3 |
|---|---|
| SMILES | CC(C)CCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCC2=CC=CC=C2 |
Product Overview
8-Methylnonyl phenylmethyl phthalate (CAS 85409-84-3), with molecular formula C25H32O4 and molecular weight 396.23007 g/mol. IUPAC: 2-O-benzyl 1-O-(8-methylnonyl) benzene-1,2-dicarboxylate.