Benzyl({1-[(3-methylphenyl)methyl]-1H-pyrrol-2-YL}methyl)(2-methylpropyl)amine
N-benzyl-2-methyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]propan-1-amine
Also Known As: BENZYL({1-[(3-METHYLPHENYL)METHYL]-1H-PYRROL-2-YL}METHYL)(2-METHYLPROPYL)AMINE|N-benzyl-2-methyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]propan-1-amine|1-[(3-Methylphenyl)methyl]-N-(2-methylpropyl)-N-(phenylmethyl)-1H-pyrrole-2-methanamine|N-Benzyl-2-methyl-N-({1-[(3-methylphenyl)methyl]-1H-pyrrol-2-yl}methyl)propan-1-amine
| Molecular Formula | C24H30N2 |
|---|---|
| Molecular Weight | 346.2409 g/mol |
| LogP | 5.50302 |
| Topological Polar Surface Area | 8.17 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Exact Mass | 346.2409 |
| Monoisotopic Mass | 346.2409 |
| Heavy Atoms | 26 |
| Complexity | 801.84265 |
Chemical Identifiers
| CAS Number | 855198-29-7 |
|---|---|
| SMILES | CC1=CC(=CC=C1)CN2C=CC=C2CN(CC3=CC=CC=C3)CC(C)C |
Product Overview
Benzyl({1-[(3-methylphenyl)methyl]-1H-pyrrol-2-YL}methyl)(2-methylpropyl)amine (CAS 855198-29-7), with molecular formula C24H30N2 and molecular weight 346.2409 g/mol. IUPAC: N-benzyl-2-methyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]propan-1-amine.
Benzyl({1-[(3-methylphenyl)methyl]-1H-pyrrol-2-YL}methyl)(2-methylpropyl)amine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »