Ethanone, 2-((1-methylethyl)amino)-1-(2,4,6-trimethoxyphenyl)-, hydrochloride
2-(propan-2-ylamino)-1-(2,4,6-trimethoxyphenyl)ethanone;hydrochloride
Also Known As: CRL 40726|N-(2,4,6-Trimethoxyphenacyl)isopropylamine chlorhydrate|Ethanone, 2-((1-methylethyl)amino)-1-(2,4,6-trimethoxyphenyl)-, hydrochloride|N-(2,4,6-Trimethoxyphenacyl)isopropylamine chlorhydrate [French]|2-((1-Methylethyl)amino)-1-(2,4,6-trimethoxyphenyl)ethanone hydrochloride|2-(propan-2-ylamino)-1-(2,4,6-trimethoxyphenyl)ethanone hydrochloride|2-[(Propan-2-yl)amino]-1-(2,4,6-trimethoxyphenyl)ethan-1-one--hydrogen chloride (1/1)
| Molecular Formula | C14H22ClNO4 |
|---|---|
| Molecular Weight | 303.12375 g/mol |
| LogP | 2.3149 |
| Topological Polar Surface Area | 56.79 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Exact Mass | 303.12375 |
| Monoisotopic Mass | 303.12375 |
| Heavy Atoms | 20 |
| Complexity | 423.7952 |
Chemical Identifiers
| CAS Number | 85540-80-3 |
|---|---|
| SMILES | CC(C)NCC(=O)C1=C(C=C(C=C1OC)OC)OC.Cl |
Product Overview
Ethanone, 2-((1-methylethyl)amino)-1-(2,4,6-trimethoxyphenyl)-, hydrochloride (CAS 85540-80-3), with molecular formula C14H22ClNO4 and molecular weight 303.12375 g/mol. IUPAC: 2-(propan-2-ylamino)-1-(2,4,6-trimethoxyphenyl)ethanone;hydrochloride.