Acetyl hexamethyl tetralin, (S)-
1-[(6S)-3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl]ethanone
Also Known As: Tonalid|(S)-Fixolide|Acetyl hexamethyl tetralin, (S)-|J1.216.574I|(S)-7-acetyl-1,1,3,4,4,6-hexamethyl-1,2,3,4-tetrahydronaphthalene|1-[(6S)-3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl]ethanone|1-[(6S)-3,5,5,6,8,8-hexamethyl-5,6,7,8-tetrahydronaphthalen-2-yl]ethan-1-one|1-[(6S)-5,6,7,8-Tetrahydro-3,5,5,6,8,8-hexamethyl-2-naphthalenyl]ethanone|1-[[(S)-3,5,5,6beta,8,8-Hexamethyl-5,6,7,8-tetrahydronaphthalene]-2-yl]ethanone|Ethanone, 1-[(6S)-5,6,7,8-tetrahydro-3,5,5,6,8,8-hexamethyl-2-naphthalenyl]-
| Molecular Formula | C18H26O |
|---|---|
| Molecular Weight | 258.19836 g/mol |
| LogP | 4.79262 |
| Topological Polar Surface Area | 17.07 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Exact Mass | 258.19836 |
| Monoisotopic Mass | 258.19836 |
| Heavy Atoms | 19 |
| Complexity | 534.8664 |
Chemical Identifiers
| CAS Number | 85549-79-7 |
|---|---|
| SMILES | C[C@H]1CC(C2=C(C1(C)C)C=C(C(=C2)C(=O)C)C)(C)C |
Product Overview
Acetyl hexamethyl tetralin, (S)- (CAS 85549-79-7), with molecular formula C18H26O and molecular weight 258.19836 g/mol. IUPAC: 1-[(6S)-3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl]ethanone.