6-[(4-Bromophenyl)methoxy]-2-[(3-methoxyphenyl)methylene]benzo[b]furan-3-one
(2Z)-6-[(4-bromophenyl)methoxy]-2-[(3-methoxyphenyl)methylidene]-1-benzofuran-3-one
Also Known As: (Z)-6-((4-bromobenzyl)oxy)-2-(3-methoxybenzylidene)benzofuran-3(2H)-one|(2Z)-6-[(4-bromobenzyl)oxy]-2-(3-methoxybenzylidene)-1-benzofuran-3(2H)-one|(2Z)-6-[(4-bromophenyl)methoxy]-2-[(3-methoxyphenyl)methylidene]-1-benzofuran-3-one|6-[(4-bromophenyl)methoxy]-2-[(3-methoxyphenyl)methylene]benzo[b]furan-3-one|6-[(4-bromophenyl)methoxy]-2-[(3-methoxyphenyl)methylidene]benzofuran-3-one
| Molecular Formula | C23H17BrO4 |
|---|---|
| Molecular Weight | 436.031 g/mol |
| LogP | 5.6529 |
| Topological Polar Surface Area | 44.76 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 436.031 |
| Monoisotopic Mass | 436.031 |
| Heavy Atoms | 28 |
| Complexity | 1054.4524 |
Chemical Identifiers
| CAS Number | 858768-87-3 |
|---|---|
| SMILES | COC1=CC=CC(=C1)/C=C\2/C(=O)C3=C(O2)C=C(C=C3)OCC4=CC=C(C=C4)Br |
Product Overview
6-[(4-Bromophenyl)methoxy]-2-[(3-methoxyphenyl)methylene]benzo[b]furan-3-one (CAS 858768-87-3), with molecular formula C23H17BrO4 and molecular weight 436.031 g/mol. IUPAC: (2Z)-6-[(4-bromophenyl)methoxy]-2-[(3-methoxyphenyl)methylidene]-1-benzofuran-3-one.
6-[(4-Bromophenyl)methoxy]-2-[(3-methoxyphenyl)methylene]benzo[b]furan-3-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »