AC1LX3SJ
[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] acetate
Also Known As: VU0617012-1|(Z)-2-(3,4-dimethoxybenzylidene)-7-methyl-3-oxo-2,3-dihydrobenzofuran-6-yl acetate|SR-01000919350-1|F3385-2309|[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] acetate|(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-3-oxo-2,3-dihydro-1-benzofuran-6-yl acetate|(2Z)-2-(3,4-dimethoxybenzylidene)-7-methyl-3-oxo-2,3-dihydro-1-benzofuran-6-yl acetate|2-[(3,4-dimethoxyphenyl)methylene]-7-methyl-3-oxobenzo[3,4-b]furan-6-yl acetat e
| Molecular Formula | C20H18O6 |
|---|---|
| Molecular Weight | 354.11035 g/mol |
| LogP | 3.55372 |
| Topological Polar Surface Area | 71.06 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Exact Mass | 354.11035 |
| Monoisotopic Mass | 354.11035 |
| Heavy Atoms | 26 |
| Complexity | 926.1389 |
Chemical Identifiers
| CAS Number | 859664-95-2 |
|---|---|
| SMILES | CC1=C(C=CC2=C1O/C(=C\C3=CC(=C(C=C3)OC)OC)/C2=O)OC(=O)C |
Product Overview
AC1LX3SJ (CAS 859664-95-2), with molecular formula C20H18O6 and molecular weight 354.11035 g/mol. IUPAC: [(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] acetate.