2-Chlorothioxanthone
2-chlorothioxanthen-9-one
Also Known As: 2-Chlorothioxanthone|2-Chloro-9H-thioxanthen-9-one|2-Chlorothioxanthen-9-one|9H-Thioxanthen-9-one, 2-chloro-|2-Chlorothiaxanthone|2-chlorothioxanthon|Sandoray 1050|2-chloro-thioxanthone|2-chloro-9-thioxanthenone|2-chlorothioxanthene-9-one|2-chloro-9-thioxanthone|2-chlorthioxanthen-9-on|ACMC-209q9m|2-chloro-thioxanthen-9-one|2-chloranylthioxanthen-9-one|cc-339|Chlorprothixene EP Impurity E|Zuclopenthixol impurity B CRS|2-Chlorothioxanthen-9-one, 98%|Thioxanthen-9-one, 2-chloro-|EINECS 201-667-2|7-Chloro-9H-thioxanthene-9-one|2-chlorodibenzo[b,e]thian-10-one|2-chlorodibenzo[b,e]thiin-10-one|2-Chloro-9H-thioxanthen-9-one #|c0292
| Molecular Formula | C13H7ClOS |
|---|---|
| Molecular Weight | 245.99062 g/mol |
| LogP | 4.6 |
| Topological Polar Surface Area | 42.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 0 |
| Exact Mass | 245.99062 |
| Monoisotopic Mass | 245.99062 |
| Heavy Atoms | 16 |
| Complexity | 294.0 |
Chemical Identifiers
| CAS Number | 86-39-5 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(S2)C=CC(=C3)Cl |
| InChIKey | ZCDADJXRUCOCJE-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 19 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-Chlorothioxanthone (CAS 86-39-5), with molecular formula C13H7ClOS and molecular weight 245.99062 g/mol. IUPAC: 2-chlorothioxanthen-9-one.