ST006071
4-methyl-N-(naphthalen-1-ylmethyl)benzenesulfonamide
Also Known As: Oprea1_004036|Oprea1_529802|4-methyl-N-(naphthalen-1-ylmethyl)benzenesulfonamide|[(4-methylphenyl)sulfonyl](naphthylmethyl)amine|N-[1]Naphthylmethyl-toluol-4-sulfonamid|N-(1-Naphthylmethyl)-p-toluenesulfonamide|4-methyl-N-[(naphthalen-1-yl)methyl]benzene-1-sulfonamide|N-[(1-Naphthyl)methyl]-p-toluenesulfonamide|J2.260.643C|N-(1-Naphthylmethyl)-4-methylbenzenesulfonamide|Benzenesulfonamide, 4-methyl-N-(1-naphthalenylmethyl)-
| Molecular Formula | C18H17NO2S |
|---|---|
| Molecular Weight | 311.098 g/mol |
| LogP | 4.0 |
| Topological Polar Surface Area | 54.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 311.098 |
| Monoisotopic Mass | 311.098 |
| Heavy Atoms | 22 |
| Complexity | 448.0 |
Chemical Identifiers
| CAS Number | 86328-84-9 |
|---|---|
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCC2=CC=CC3=CC=CC=C32 |
| InChIKey | MPHNFTCUDMPWLY-UHFFFAOYSA-N |
Product Overview
ST006071 (CAS 86328-84-9), with molecular formula C18H17NO2S and molecular weight 311.098 g/mol. IUPAC: 4-methyl-N-(naphthalen-1-ylmethyl)benzenesulfonamide.
ST006071 is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »