9-Chlorohexadecafluorononanoic Acid
9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoic acid
Also Known As: 9-Chlorohexadecafluorononanoic Acid|9-Chloroperfluorononanoic acid|9-Chloro-perfluorononanoic acid|ClPFLCAs_i n=8|9Cl-PFNA|ACMC-209qaf|C9HClF16O2|9-chloro-prefluorononanoic acid|9-CHLOROHEXADECAFLUORONONANOICACID|9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoic acid|9-Chloroperfluorononanoic acid 250g|BAS 00094465|J3.151.854G|9-Chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-nonanoic acid|Nonanoic acid,9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-|678-367-7
| Molecular Formula | C9HClF16O2 |
|---|---|
| Molecular Weight | 479.94095 g/mol |
| LogP | 5.3497 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Exact Mass | 479.94095 |
| Monoisotopic Mass | 479.94095 |
| Heavy Atoms | 28 |
| Complexity | 620.09467 |
Chemical Identifiers
| CAS Number | 865-79-2 |
|---|---|
| SMILES | C(=O)(C(C(C(C(C(C(C(C(F)(F)Cl)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Product Overview
9-Chlorohexadecafluorononanoic Acid (CAS 865-79-2), with molecular formula C9HClF16O2 and molecular weight 479.94095 g/mol. IUPAC: 9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoic acid.