4-(5-Chloro-2-methylphenyl)-1-(2-naphthylsulfonyl)piperazine
1-(5-chloro-2-methylphenyl)-4-naphthalen-2-ylsulfonylpiperazine
Also Known As: KS-00003NKT|4-(5-CHLORO-2-METHYLPHENYL)-1-(2-NAPHTHYLSULFONYL)PIPERAZINE|1-(5-chloro-2-methylphenyl)-4-naphthalen-2-ylsulfonylpiperazine|1-(5-chloro-2-methyl-phenyl)-4-(2-naphthylsulfonyl)piperazine|1-(5-chloro-2-methyl-phenyl)-4-naphthalen-2-ylsulfonyl-piperazine|1-(5-chloro-2-methylphenyl)-4-(naphthalene-2-sulfonyl)piperazine
| Molecular Formula | C21H21ClN2O2S |
|---|---|
| Molecular Weight | 400.10123 g/mol |
| LogP | 4.31252 |
| Topological Polar Surface Area | 40.62 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 400.10123 |
| Monoisotopic Mass | 400.10123 |
| Heavy Atoms | 27 |
| Complexity | 1090.2869 |
Chemical Identifiers
| CAS Number | 865548-75-0 |
|---|---|
| SMILES | CC1=C(C=C(C=C1)Cl)N2CCN(CC2)S(=O)(=O)C3=CC4=CC=CC=C4C=C3 |
Product Overview
4-(5-Chloro-2-methylphenyl)-1-(2-naphthylsulfonyl)piperazine (CAS 865548-75-0), with molecular formula C21H21ClN2O2S and molecular weight 400.10123 g/mol. IUPAC: 1-(5-chloro-2-methylphenyl)-4-naphthalen-2-ylsulfonylpiperazine.
4-(5-Chloro-2-methylphenyl)-1-(2-naphthylsulfonyl)piperazine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »