AC1M22ZL
8-[(3-methoxyphenyl)methyl]-5-(4-methylphenyl)-12,14-dioxa-3,4,8-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2,4,6,9,11(15)-hexaene
Also Known As: AB00674887-01|8-[(3-methoxyphenyl)methyl]-5-(4-methylphenyl)-12,14-dioxa-3,4,8-triazatetracyclo[7.7.0.0^{2,6}.0^{11,15}]hexadeca-1(16),2,4,6,9,11(15)-hexaene|F1602-0829|5-(3-methoxybenzyl)-3-(4-methylphenyl)-5H-[1,3]dioxolo[4,5-g]pyrazolo[4,3-c]quinoline|8-[(3-methoxyphenyl)methyl]-5-(4-methylphenyl)-12,14-dioxa-3,4,8-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2,4,6,9,11(15)-hexaene
| Molecular Formula | C26H21N3O3 |
|---|---|
| Molecular Weight | 423.1583 g/mol |
| LogP | 5.29712 |
| Topological Polar Surface Area | 58.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 423.1583 |
| Monoisotopic Mass | 423.1583 |
| Heavy Atoms | 32 |
| Complexity | 1422.838 |
Chemical Identifiers
| CAS Number | 866348-49-4 |
|---|---|
| SMILES | CC1=CC=C(C=C1)C2=NN=C3C2=CN(C4=CC5=C(C=C43)OCO5)CC6=CC(=CC=C6)OC |
Product Overview
AC1M22ZL (CAS 866348-49-4), with molecular formula C26H21N3O3 and molecular weight 423.1583 g/mol. IUPAC: 8-[(3-methoxyphenyl)methyl]-5-(4-methylphenyl)-12,14-dioxa-3,4,8-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2,4,6,9,11(15)-hexaene.