Dimethyl (2,2,2-trichloro-1-methoxyethyl)phosphonate
1,1,1-trichloro-2-dimethoxyphosphoryl-2-methoxyethane
Also Known As: NIOSH/SZ9061000|Dimethyl (2,2,2-trichloro-1-methoxyethyl)phosphonate|1,1,1-trichloro-2-dimethoxyphosphoryl-2-methoxyethane|dimethyl(2,2,2-trichloro-1-methoxyethyl)phosphonate|O,O-Dimethyl-2,2,2-trichlor-1-methoxy-ethylphosphonat|O,O-Dimethyl (1-methoxy-2,2,2-trichloroethyl)phosphonate|Phosphonic acid, (2,2,2-trichloro-1-methoxyethyl)-, dimethyl ester|(1-Methoxy-2,2,2-trichloroethyl)phosphonic acid O,O-dimethyl ester|Phosphonic acid, (1-methoxy-2,2,2-trichloroethyl)-, O,O-dimethyl
| Molecular Formula | C5H10Cl3O4P |
|---|---|
| Molecular Weight | 269.93823 g/mol |
| LogP | 1.3 |
| Topological Polar Surface Area | 44.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 269.93823 |
| Monoisotopic Mass | 269.93823 |
| Heavy Atoms | 13 |
| Complexity | 196.0 |
Chemical Identifiers
| CAS Number | 867-73-2 |
|---|---|
| SMILES | COC(C(Cl)(Cl)Cl)P(=O)(OC)OC |
| InChIKey | JRIDIMGTKIMVDT-UHFFFAOYSA-N |
Product Overview
Dimethyl (2,2,2-trichloro-1-methoxyethyl)phosphonate (CAS 867-73-2), with molecular formula C5H10Cl3O4P and molecular weight 269.93823 g/mol. IUPAC: 1,1,1-trichloro-2-dimethoxyphosphoryl-2-methoxyethane.