Strontium tartrate
strontium (2R,3R)-2,3-dihydroxybutanedioate
Also Known As: Strontium tartrate|strontium(2+) TAR|L-Tartaric acid strontium salt|Tartaric acid, strontium salt (1:1)|EC 212-774-9|strontium (2R,3R)-2,3-dihydroxybutanedioate|Tartaric acid, strontium salt (1:1) (8CI)|Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, strontium salt (1:1)|2,3-dihydroxy-[theta-(theta,theta)]-butanedioicacistrontiumsalt(1:1|Butanedioic acid, 2,3-dihydroxy-(2R,3R)-, strontium salt (1:1)|Butanedioic acid, 2,3-dihydroxy- (R-(R*,R*))-, strontium salt (1:1)|Butanedioic acid, 2,3-dihydroxy- [R-(R*,R*)]-, strontium salt (1:1)|Butanedioic acid, 2,3-dihydroxy-(R-(R*,R*))-, strontium salt (1:1)|Butanedioic acid, 2,3-dihydroxy-(R-(R*,R*))-, strontium salt (1:1) (9CI)|212-774-9
| Molecular Formula | C4H4O6Sr |
|---|---|
| Molecular Weight | 235.9064 g/mol |
| LogP | -5.1728 |
| Topological Polar Surface Area | 121.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Exact Mass | 235.9064 |
| Monoisotopic Mass | 235.9064 |
| Heavy Atoms | 11 |
| Complexity | 123.0 |
Chemical Identifiers
| CAS Number | 868-19-9 |
|---|---|
| SMILES | [C@@H]([C@H](C(=O)[O-])O)(C(=O)[O-])O.[Sr+2] |
| InChIKey | IUMOPUXDPFMEMV-ZVGUSBNCSA-L |
Product Overview
Strontium tartrate (CAS 868-19-9), with molecular formula C4H4O6Sr and molecular weight 235.9064 g/mol. IUPAC: strontium (2R,3R)-2,3-dihydroxybutanedioate.