AC1OH3HX
8-[(dimethylamino)methyl]-7-hydroxy-3-(4-methoxyphenyl)-4-methylchromen-2-one
Also Known As: 8-[(dimethylamino)methyl]-7-hydroxy-3-(4-methoxyphenyl)-4-methyl-2H-chromen-2-one|8-((dimethylamino)methyl)-7-hydroxy-3-(4-methoxyphenyl)-4-methyl-2H-chromen-2-one|F1862-0669|8-[(dimethylamino)methyl]-7-hydroxy-3-(4-methoxyphenyl)-4-methylchromen-2-one|8-(dimethylaminomethyl)-7-hydroxy-3-(4-methoxyphenyl)-4-methyl-chromen-2-one|8-(dimethylaminomethyl)-7-hydroxy-3-(4-methoxyphenyl)-4-methylchromen-2-one|8-[(dimethylamino)methyl]-7-hydroxy-3-(4-methoxyphenyl)-4-methyl-2 h -chromen-2-one
| Molecular Formula | C20H21NO4 |
|---|---|
| Molecular Weight | 339.14706 g/mol |
| LogP | 3.54422 |
| Topological Polar Surface Area | 62.91 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 339.14706 |
| Monoisotopic Mass | 339.14706 |
| Heavy Atoms | 25 |
| Complexity | 971.63806 |
Chemical Identifiers
| CAS Number | 869080-99-9 |
|---|---|
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2CN(C)C)O)C3=CC=C(C=C3)OC |
Product Overview
AC1OH3HX (CAS 869080-99-9), with molecular formula C20H21NO4 and molecular weight 339.14706 g/mol. IUPAC: 8-[(dimethylamino)methyl]-7-hydroxy-3-(4-methoxyphenyl)-4-methylchromen-2-one.