1-Pyrenylalanine
(2S)-2-amino-3-pyren-1-ylpropanoic acid
Also Known As: 1-Pyrenylalanine|pyrenylalanine|1-PYA|3-(1-Pyrenyl)alanine|H-Ala(1-Pyn)-OH|H-L-Ala(1-Pyn)-OH|l-3-(1'-pyrenyl)alanine|3-(1-Pyrenyl)-L-alanine|3-(3-Pyrenyl)-L-alanine|beta-(1-Pyrenyl)-L-alanine|3-(Pyrene-1-yl)-L-alanine|(2S)-2-amino-3-pyren-1-ylpropanoic acid|(2s)-2-amino-3-pyrenylpropanoic acid|(S)-2-Amino-3-(pyren-1-yl)propanoic acid|(S)-2-Amino-3-(pyrene-1-yl)propanoic acid|1-Pyrenepropanoic acid, alpha-amino-, (S)-|(2S)-2-AMINO-3-(PYREN-1-YL)PROPANOIC ACID
| Molecular Formula | C19H15NO2 |
|---|---|
| Molecular Weight | 289.1103 g/mol |
| LogP | 1.7 |
| Topological Polar Surface Area | 63.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 289.1103 |
| Monoisotopic Mass | 289.1103 |
| Heavy Atoms | 22 |
| Complexity | 437.0 |
Chemical Identifiers
| CAS Number | 87147-90-8 |
|---|---|
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)C[C@@H](C(=O)O)N |
| InChIKey | VTMOPDBUZPBOPL-INIZCTEOSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1-Pyrenylalanine (CAS 87147-90-8), with molecular formula C19H15NO2 and molecular weight 289.1103 g/mol. IUPAC: (2S)-2-amino-3-pyren-1-ylpropanoic acid.