6-Methylflavone-8-acetic acid
2-(6-methyl-4-oxo-2-phenylchromen-8-yl)acetic acid
Also Known As: 6-Methylflavone-8-acetic acid|6-Methylflavone-8-acetate|6-Me-Flavone-8-acetate|2-(6-Methyl-4-oxo-2-phenyl-4H-chromen-8-yl)acetic acid|2-(6-methyl-4-oxo-2-phenylchromen-8-yl)acetic acid|6-Methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-acetic acid|4H-1-Benzopyran-8-acetic acid, 6-methyl-4-oxo-2-phenyl-|2-(6-Methyl-4-oxo-2-phenyl-4H-chromen-8-yl)aceticacid|2-Phenyl-4-oxo-6-methyl-4H-1-benzopyran-8-acetic acid|(6-Methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-yl)acetic acid
| Molecular Formula | C18H14O4 |
|---|---|
| Molecular Weight | 294.0892 g/mol |
| LogP | 3.0 |
| Topological Polar Surface Area | 63.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 294.0892 |
| Monoisotopic Mass | 294.0892 |
| Heavy Atoms | 22 |
| Complexity | 475.0 |
Chemical Identifiers
| CAS Number | 87626-74-2 |
|---|---|
| SMILES | CC1=CC(=C2C(=C1)C(=O)C=C(O2)C3=CC=CC=C3)CC(=O)O |
| InChIKey | PXDPYVSPUBJYGI-UHFFFAOYSA-N |
Product Overview
6-Methylflavone-8-acetic acid (CAS 87626-74-2), with molecular formula C18H14O4 and molecular weight 294.0892 g/mol. IUPAC: 2-(6-methyl-4-oxo-2-phenylchromen-8-yl)acetic acid.
6-Methylflavone-8-acetic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »