1-(3-Chlorophenyl)-3-(dimethylamino)-2-propen-1-one
1-(3-chlorophenyl)-3-(dimethylamino)prop-2-en-1-one
Also Known As: KS-00001WEY|1-(3-chlorophenyl)-3-(dimethylamino)-2-propen-1-one|1-(3-chlorophenyl)-3-(dimethylamino)prop-2-en-1-one|3'-chloro-3-dimethylaminoacrylophenone|(2E)-1-(3-chlorophenyl)-3-(dimethylamino)prop-2-en-1-one|1-(3-Chlorophenyl)-3-dimethylaminopropenone|2-Propen-1-one, 1-(3-chlorophenyl)-3-(dimethylamino)-|(E)-1-(3-CHLOROPHENYL)-3-DIMETHYLAMINOPROPENONE|(E)-1-(3-chlorophenyl)-3-(dimethylamino)prop-2-en-1-one|(2Z)-1-(3-chlorophenyl)-3-(dimethylamino)prop-2-en-1-one
| Molecular Formula | C11H12ClNO |
|---|---|
| Molecular Weight | 209.06075 g/mol |
| LogP | 2.9 |
| Topological Polar Surface Area | 20.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 209.06075 |
| Monoisotopic Mass | 209.06075 |
| Heavy Atoms | 14 |
| Complexity | 225.0 |
Chemical Identifiers
| CAS Number | 876376-75-9 |
|---|---|
| SMILES | CN(C)C=CC(=O)C1=CC(=CC=C1)Cl |
| InChIKey | LDBZHHVGVAIVBT-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1-(3-Chlorophenyl)-3-(dimethylamino)-2-propen-1-one (CAS 876376-75-9), with molecular formula C11H12ClNO and molecular weight 209.06075 g/mol. IUPAC: 1-(3-chlorophenyl)-3-(dimethylamino)prop-2-en-1-one.