3,4'-Difluoro-4-methoxybenzophenone
(3-fluoro-4-methoxyphenyl)-(4-fluorophenyl)methanone
Also Known As: 3,4'-Difluoro-4-methoxybenzophenone|EINECS 289-342-1|3,4-Difluoro-4'-methoxybenzophenone|(3-FLUORO-4-METHOXYPHENYL)(4-FLUOROPHENYL)METHANONE|(3-fluoro-4-methoxyphenyl)-(4-fluorophenyl)methanone|(2-chlorophenyl)-(2-fluoro-4-hydroxyphenyl)methanone|(2-chlorophenyl)-(4-fluoro-2-hydroxyphenyl)methanone|(3-Fluoro-4-methoxy-phenyl)-(4-fluoro-phenyl)-methanone|[1-tert-butyl-3-(chloromethyl)-2-oxoazetidin-3-yl] benzoate|289-342-1
| Molecular Formula | C14H10F2O2 |
|---|---|
| Molecular Weight | 248.06488 g/mol |
| LogP | 3.2044 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 248.06488 |
| Monoisotopic Mass | 248.06488 |
| Heavy Atoms | 18 |
| Complexity | 576.8479 |
Chemical Identifiers
| CAS Number | 87750-98-9 |
|---|---|
| SMILES | COC1=C(C=C(C=C1)C(=O)C2=CC=C(C=C2)F)F |
Product Overview
3,4'-Difluoro-4-methoxybenzophenone (CAS 87750-98-9), with molecular formula C14H10F2O2 and molecular weight 248.06488 g/mol. IUPAC: (3-fluoro-4-methoxyphenyl)-(4-fluorophenyl)methanone.
3,4'-Difluoro-4-methoxybenzophenone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »