Denticulatin B
(E,2S,4R)-2-[(2S,3S,4S,5R)-2,4-dihydroxy-3,5-dimethyl-6-[(2S)-3-oxopentan-2-yl]oxan-2-yl]-4,6-dimethylnon-6-en-3-one
Also Known As: Denticulatin A|DENTICULATIN B|(2S)-Tetrahydro-3beta,5beta-dimethyl-2alpha-[(1S,3R,5E)-1,3,5-trimethyl-2-oxo-5-octenyl]-6-[(1S)-1-methyl-2-oxobutyl]-2H-pyran-2beta,4beta-diol|(2S,4R,6E)-2-[(2S,3S,4S,5R)-2,4-dihydroxy-3,5-dimethyl-6-[(2S)-3-oxopentan-2-yl]oxan-2-yl]-4,6-dimethylnon-6-en-3-one|(E,2S,4R)-2-[(2S,3S,4S,5R)-2,4-dihydroxy-3,5-dimethyl-6-[(2S)-3-oxopentan-2-yl]oxan-2-yl]-4,6-dimethylnon-6-en-3-one
| Molecular Formula | C23H40O5 |
|---|---|
| Molecular Weight | 396.28757 g/mol |
| LogP | 3.9098 |
| Topological Polar Surface Area | 83.83 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Exact Mass | 396.28757 |
| Monoisotopic Mass | 396.28757 |
| Heavy Atoms | 28 |
| Complexity | 583.54175 |
Chemical Identifiers
| CAS Number | 87758-52-9 |
|---|---|
| SMILES | CC/C=C(\C)/C[C@@H](C)C(=O)[C@H](C)[C@@]1([C@H]([C@H]([C@H](C(O1)[C@H](C)C(=O)CC)C)O)C)O |
Product Overview
Denticulatin B (CAS 87758-52-9), with molecular formula C23H40O5 and molecular weight 396.28757 g/mol. IUPAC: (E,2S,4R)-2-[(2S,3S,4S,5R)-2,4-dihydroxy-3,5-dimethyl-6-[(2S)-3-oxopentan-2-yl]oxan-2-yl]-4,6-dimethylnon-6-en-3-one.
Denticulatin B is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »