1,3,2-Dioxaphosphorinane, 5,5-dimethyl-2-phenyl-, 2-oxide
5,5-dimethyl-2-phenyl-1,3,2λ5-dioxaphosphinane 2-oxide
Also Known As: 5,5-dimethyl-2-phenyl-1,3,2|1,3,2-Dioxaphosphorinane, 5,5-dimethyl-2-phenyl-, 2-oxide|5,5-Dimethyl-2-phenyl-1,3,2-dioxaphosphinane 2-Oxide|1,3-Propanediol, 2,2-dimethyl-, cyclic phenyl phosphonate|2-oxo-2-phenyl-5,5-dimethyl-1,3,2-dioxaphosphorinane|2-Phenyl-2-oxo-5,5-dimethyl-1,3,2-dioxaphosphorinan|5,5-dimethyl-2-phenyl-1,3,2|E5-dioxaphosphinane 2-oxide|5,5-Dimethyl-2-phenyl-1,3,2lambda~5~-dioxaphosphinan-2-one|Phosphonic acid, phenyl-, cyclic 2,2-dimethyltrimethylene ester
| Molecular Formula | C11H15O3P |
|---|---|
| Molecular Weight | 226.07588 g/mol |
| LogP | 2.0 |
| Topological Polar Surface Area | 35.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 226.07588 |
| Monoisotopic Mass | 226.07588 |
| Heavy Atoms | 15 |
| Complexity | 255.0 |
Chemical Identifiers
| CAS Number | 882-69-9 |
|---|---|
| SMILES | CC1(COP(=O)(OC1)C2=CC=CC=C2)C |
| InChIKey | IBGSBHZFACCHSP-UHFFFAOYSA-N |
Product Overview
1,3,2-Dioxaphosphorinane, 5,5-dimethyl-2-phenyl-, 2-oxide (CAS 882-69-9), with molecular formula C11H15O3P and molecular weight 226.07588 g/mol. IUPAC: 5,5-dimethyl-2-phenyl-1,3,2λ5-dioxaphosphinane 2-oxide.