AC1NGIK2
3-(2,3-dimethylphenyl)-1-(2-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one
Also Known As: VU0509483-1|VU0509483-2|AB00682941-01|1-(2,3-dimethylphenyl)-3-(2-methylphenyl)tetrahydro-1H-thieno[3,4-d]imidazol-2(3H)-one 5,5-dioxide|F3118-0039|3-(2,3-dimethylphenyl)-1-(2-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one|1-(2,3-dimethylphenyl)-3-(o-tolyl)tetrahydro-1H-thieno[3,4-d]imidazol-2(3H)-one 5,5-dioxide|6-(2,3-dimethylphenyl)-4-(2-methylphenyl)-1,3,4,6,3a,6a-hexahydro-2-thia-4,6-d iazapentalene-2,2,5-trione
| Molecular Formula | C20H22N2O3S |
|---|---|
| Molecular Weight | 370.1351 g/mol |
| LogP | 3.22406 |
| Topological Polar Surface Area | 57.69 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 370.1351 |
| Monoisotopic Mass | 370.1351 |
| Heavy Atoms | 26 |
| Complexity | 999.8659 |
Chemical Identifiers
| CAS Number | 883265-72-3 |
|---|---|
| SMILES | CC1=C(C(=CC=C1)N2C3CS(=O)(=O)CC3N(C2=O)C4=CC=CC=C4C)C |
Product Overview
AC1NGIK2 (CAS 883265-72-3), with molecular formula C20H22N2O3S and molecular weight 370.1351 g/mol. IUPAC: 3-(2,3-dimethylphenyl)-1-(2-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one.