(Diphenylphosphoryl)methanol
diphenylphosphorylmethanol
Also Known As: (Diphenylphosphoryl)methanol|diphenylphosphorylmethanol|(diphenylphosphoroso)methanol|Methanol, (diphenylphosphinyl)-|(Hydroxymethyl)diphenylphosphine oxide|CBMicro_005054|(Diphenylphosphinyl)methanol|(Diphenylphosphoryl)methanol #|1-(Diphenylphosphinyl)methanol|hydroxymethyldiphenylphosphine oxide|(DIPHENYLPHOSPHINYL)-METHANOL|Hydroxymethyl diphenylphosphine oxide|KM2616|(hydroxymethyl)diphenylphosphino-1-one|BIM-0004940.P001|J1.034.783A|AE-848/30708062|AG-690/11959188|813-898-1
| Molecular Formula | C13H13O2P |
|---|---|
| Molecular Weight | 232.06532 g/mol |
| LogP | 1.9 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 232.06532 |
| Monoisotopic Mass | 232.06532 |
| Heavy Atoms | 16 |
| Complexity | 231.0 |
Chemical Identifiers
| CAS Number | 884-74-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)P(=O)(CO)C2=CC=CC=C2 |
| InChIKey | NSLPWSVZTYOGDO-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(Diphenylphosphoryl)methanol (CAS 884-74-2), with molecular formula C13H13O2P and molecular weight 232.06532 g/mol. IUPAC: diphenylphosphorylmethanol.