Methyl 2-amino-4-(4-chlorophenyl)-5-methyl-3-thiophenecarboxylate
methyl 2-amino-4-(4-chlorophenyl)-5-methylthiophene-3-carboxylate
Also Known As: methyl 2-amino-4-(4-chlorophenyl)-5-methylthiophene-3-carboxylate|CBMicro_046725|1165AE|3-Isopropoxy-benzoic acid methyl ester|methyl 2-amino-4-(4-chlorophenyl)-5-methyl-3-thiophenecarboxylate|BIM-0046743.P001|W-8820|2-Amino-4-(4-chloro-phenyl)-5-methyl-thiophene-3-carboxylic acid methyl ester|AB00102903-01|AK-968/13779302|SR-01000228635-1|methyl 2-amino-4-(4-chlorophenyl)-5-methyl-thiophene-3-carboxylate|2-amino-4-(4-chlorophenyl)-5-methyl-thiophene-3-carboxylic acid methyl ester
| Molecular Formula | C13H12ClNO2S |
|---|---|
| Molecular Weight | 281.02774 g/mol |
| LogP | 3.74572 |
| Topological Polar Surface Area | 52.32 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 281.02774 |
| Monoisotopic Mass | 281.02774 |
| Heavy Atoms | 18 |
| Complexity | 589.7839 |
Chemical Identifiers
| CAS Number | 889357-64-6 |
|---|---|
| SMILES | CC1=C(C(=C(S1)N)C(=O)OC)C2=CC=C(C=C2)Cl |
Product Overview
Methyl 2-amino-4-(4-chlorophenyl)-5-methyl-3-thiophenecarboxylate (CAS 889357-64-6), with molecular formula C13H12ClNO2S and molecular weight 281.02774 g/mol. IUPAC: methyl 2-amino-4-(4-chlorophenyl)-5-methylthiophene-3-carboxylate.